C22H24F3N3O3 — CID 91899465
5-[3-(dimethylamino)propylideneamino]-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol (PubChem CID 91899465) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylideneamino]-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol.
| Compound Name | 5-[3-(dimethylamino)propylideneamino]-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol |
|---|---|
| PubChem CID | 91899465 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 5-[3-(dimethylamino)propylideneamino]-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol |
| SMILES | Cc1c(COc2c(F)cc(F)cc2F)c2c(O)c(/N=C/CCN(C)C)cc(O)c2n1C |
| InChI | InChI=1S/C22H24F3N3O3/c1-12-14(11-31-22-15(24)8-13(23)9-16(22)25)19-20(28(12)4)18(29)10-17(21(19)30)26-6-5-7-27(2)3/h6,8-10,29-30H,5,7,11H2,1-4H3/b26-6+ |
| InChIKey | XUBMDINRTLILKF-GOTRBWPWSA-N |
| XLogP | 4.55 |
| TPSA | 70.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|