C25H27N3O4 — CID 91899474
(10R)-13-tert-butyl-10-(2,4-dimethoxyphenyl)-14-hydroxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one (PubChem CID 91899474) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is (10R)-13-tert-butyl-10-(2,4-dimethoxyphenyl)-14-hydroxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one.
| Compound Name | (10R)-13-tert-butyl-10-(2,4-dimethoxyphenyl)-14-hydroxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
|---|---|
| PubChem CID | 91899474 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (10R)-13-tert-butyl-10-(2,4-dimethoxyphenyl)-14-hydroxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccccc4c3Cc3c(O)n(C(C)(C)C)c(=O)n32)c(OC)c1 |
| InChI | InChI=1S/C25H27N3O4/c1-25(2,3)28-23(29)19-13-17-15-8-6-7-9-18(15)26-21(17)22(27(19)24(28)30)16-11-10-14(31-4)12-20(16)32-5/h6-12,22,26,29H,13H2,1-5H3/t22-/m1/s1 |
| InChIKey | QWKOMLLJXATSJE-JOCHJYFZSA-N |
| XLogP | 4.15 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|