C15H17N3S — CID 91899728
1-phenylethyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)diazene (PubChem CID 91899728) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-phenylethyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)diazene.
| Compound Name | 1-phenylethyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)diazene |
|---|---|
| PubChem CID | 91899728 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-phenylethyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)diazene |
| SMILES | CC(/N=N/c1nc2c(s1)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C15H17N3S/c1-11(12-7-3-2-4-8-12)17-18-15-16-13-9-5-6-10-14(13)19-15/h2-4,7-8,11H,5-6,9-10H2,1H3/b18-17+ |
| InChIKey | CSHIGVQPPMCKRO-ISLYRVAYSA-N |
| XLogP | 4.87 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|