About 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol
2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol (PubChem CID 91900127) has the molecular formula C18H22O5S
and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol.
Molecular Properties
| Compound Name | 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol |
| PubChem CID | 91900127 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol |
| SMILES | CCCC/C=C/S(=O)c1cc(O)c2c(OC)ccc(OC)c2c1O |
| InChI | InChI=1S/C18H22O5S/c1-4-5-6-7-10-24(21)15-11-12(19)16-13(22-2)8-9-14(23-3)17(16)18(15)20/h7-11,19-20H,4-6H2,1-3H3/b10-7+ |
| InChIKey | FUMUNQLQWYELGF-JXMROGBWSA-N |
| XLogP | 4.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol?
The IUPAC name of 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol (CID 91900127) is 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol.
What is the SMILES notation for 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol?
The canonical SMILES for 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol is CCCC/C=C/S(=O)c1cc(O)c2c(OC)ccc(OC)c2c1O.
What is the InChIKey of 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol?
The InChIKey is FUMUNQLQWYELGF-JXMROGBWSA-N. The full InChI is InChI=1S/C18H22O5S/c1-4-5-6-7-10-24(21)15-11-12(19)16-13(22-2)8-9-14(23-3)17(16)18(15)20/h7-11,19-20H,4-6H2,1-3H3/b10-7+.
What are the key properties of 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol?
2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol has a molecular weight of 350.44 g/mol, XLogP of 4.08, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hex-1-enyl]sulfinyl-5,8-dimethoxynaphthalene-1,4-diol is sourced from PubChem (CID 91900127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).