C11H14BN5O12P3S-4 — CID 91900237
CID 91900237 (PubChem CID 91900237) has the molecular formula C11H14BN5O12P3S-4 and a molecular weight of 544.06 g/mol.
| Compound Name | CID 91900237 |
|---|---|
| PubChem CID | 91900237 |
| Molecular Formula | C11H14BN5O12P3S-4 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.97 |
| IUPAC Name | — |
| SMILES | [B-]P(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(SC)nc32)[C@H](O)[C@H]1O)OP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C11H17BN5O12P3S/c1-33-11-15-8(13)5-9(16-11)17(3-14-5)10-7(19)6(18)4(27-10)2-26-30(12,20)28-32(24,25)29-31(21,22)23/h3-4,6-7,10,18-19H,2H2,1H3,(H,24,25)(H2,13,15,16)(H2,21,22,23)/q-1/p-3/t4-,6+,7-,10-,30?/m1/s1 |
| InChIKey | FXLSEPQOLCSIQH-GGPRBHIUSA-K |
| XLogP | -2.63 |
| TPSA | 267.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|