C25H30O5 — CID 91900269
(5Z)-5-[(Z,2R)-9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-3-methyloxolane-2,4-dione (PubChem CID 91900269) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is (5Z)-5-[(Z,2R)-9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-3-methyloxolane-2,4-dione.
| Compound Name | (5Z)-5-[(Z,2R)-9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-3-methyloxolane-2,4-dione |
|---|---|
| PubChem CID | 91900269 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (5Z)-5-[(Z,2R)-9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-3-methyloxolane-2,4-dione |
| SMILES | C/C(=C/CC[C@@H](C)/C=C1\OC(=O)C(C)C1=O)CCCc1coc(Cc2ccoc2)c1 |
| InChI | InChI=1S/C25H30O5/c1-17(6-4-8-18(2)12-23-24(26)19(3)25(27)30-23)7-5-9-20-13-22(29-16-20)14-21-10-11-28-15-21/h6,10-13,15-16,18-19H,4-5,7-9,14H2,1-3H3/b17-6-,23-12-/t18-,19?/m1/s1 |
| InChIKey | LNDMURLDCJJLHT-ULGIURPJSA-N |
| XLogP | 5.79 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|