C19H22N2O6S — CID 9190049
N-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methyl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 9190049) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methyl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methyl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9190049 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methyl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | CCOc1cc2c(cc1CNS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1)O[C@H](C)C2 |
| InChI | InChI=1S/C19H22N2O6S/c1-4-26-18-8-14-7-13(3)27-19(14)9-15(18)11-20-28(24,25)16-6-5-12(2)17(10-16)21(22)23/h5-6,8-10,13,20H,4,7,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | ZAUBBILNOXEQOB-CYBMUJFWSA-N |
| XLogP | 3.10 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|