About 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol
5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol (PubChem CID 91901086) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol |
| PubChem CID | 91901086 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol |
| SMILES | Cc1ccc(N2CC3C4CC5C(OC2C35)C4O)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-8-2-4-9(5-3-8)17-7-12-10-6-11-13(12)16(17)19-15(11)14(10)18/h2-5,10-16,18H,6-7H2,1H3 |
| InChIKey | IDOOXBNMGJXFAS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol?
The IUPAC name of 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol (CID 91901086) is 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol.
What is the SMILES notation for 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol?
The canonical SMILES for 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol is Cc1ccc(N2CC3C4CC5C(OC2C35)C4O)cc1.
What is the InChIKey of 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol?
The InChIKey is IDOOXBNMGJXFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-8-2-4-9(5-3-8)17-7-12-10-6-11-13(12)16(17)19-15(11)14(10)18/h2-5,10-16,18H,6-7H2,1H3.
What are the key properties of 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol?
5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol has a molecular weight of 257.33 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-9-ol is sourced from PubChem (CID 91901086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).