C17H19BClNO3S — CID 91901647
(2-chlorophenyl)-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methanone (PubChem CID 91901647) has the molecular formula C17H19BClNO3S and a molecular weight of 363.68 g/mol. Its IUPAC name is (2-chlorophenyl)-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methanone.
| Compound Name | (2-chlorophenyl)-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methanone |
|---|---|
| PubChem CID | 91901647 |
| Molecular Formula | C17H19BClNO3S |
| Molecular Weight | 363.68 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (2-chlorophenyl)-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methanone |
| SMILES | Cc1nc(C(=O)c2ccccc2Cl)sc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H19BClNO3S/c1-10-14(18-22-16(2,3)17(4,5)23-18)24-15(20-10)13(21)11-8-6-7-9-12(11)19/h6-9H,1-5H3 |
| InChIKey | XTULVOKLQSQOPQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|