C20H26FN5O2 — CID 91903526
4-[2-[(2-ethylpyrazole-3-carbonyl)amino]ethyl]-N-(4-fluorophenyl)piperidine-1-carboxamide (PubChem CID 91903526) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[2-[(2-ethylpyrazole-3-carbonyl)amino]ethyl]-N-(4-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-[(2-ethylpyrazole-3-carbonyl)amino]ethyl]-N-(4-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91903526 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-[2-[(2-ethylpyrazole-3-carbonyl)amino]ethyl]-N-(4-fluorophenyl)piperidine-1-carboxamide |
| SMILES | CCn1nccc1C(=O)NCCC1CCN(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FN5O2/c1-2-26-18(8-12-23-26)19(27)22-11-7-15-9-13-25(14-10-15)20(28)24-17-5-3-16(21)4-6-17/h3-6,8,12,15H,2,7,9-11,13-14H2,1H3,(H,22,27)(H,24,28) |
| InChIKey | VHONIEWDHWSTTN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |