C23H23ClN6O — CID 91904801
N-[1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1-methylindazole-3-carboxamide (PubChem CID 91904801) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is N-[1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1-methylindazole-3-carboxamide.
| Compound Name | N-[1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 91904801 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1-methylindazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NC2CCCN(c3cc(-c4ccc(Cl)cc4)[nH]n3)C2)c2ccccc21 |
| InChI | InChI=1S/C23H23ClN6O/c1-29-20-7-3-2-6-18(20)22(28-29)23(31)25-17-5-4-12-30(14-17)21-13-19(26-27-21)15-8-10-16(24)11-9-15/h2-3,6-11,13,17H,4-5,12,14H2,1H3,(H,25,31)(H,26,27) |
| InChIKey | IXXMZNFXFGINTB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |