About 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine
4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 91904987) has the molecular formula C17H19F3N4O2S
and a molecular weight of 400.43 g/mol. Its IUPAC name is 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine.
Molecular Properties
| Compound Name | 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
| PubChem CID | 91904987 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCC(n2cnnc2C2CC2)CC1 |
| InChI | InChI=1S/C17H19F3N4O2S/c18-17(19,20)13-2-1-3-15(10-13)27(25,26)23-8-6-14(7-9-23)24-11-21-22-16(24)12-4-5-12/h1-3,10-12,14H,4-9H2 |
| InChIKey | DVBKFWUNFWJCQG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine?
The IUPAC name of 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine (CID 91904987) is 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine.
What is the SMILES notation for 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine?
The canonical SMILES for 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine is O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCC(n2cnnc2C2CC2)CC1.
What is the InChIKey of 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine?
The InChIKey is DVBKFWUNFWJCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N4O2S/c18-17(19,20)13-2-1-3-15(10-13)27(25,26)23-8-6-14(7-9-23)24-11-21-22-16(24)12-4-5-12/h1-3,10-12,14H,4-9H2.
What are the key properties of 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine?
4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine has a molecular weight of 400.43 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine is sourced from PubChem (CID 91904987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).