About 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide
5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide (PubChem CID 91905232) has the molecular formula C14H20FNO3S
and a molecular weight of 301.38 g/mol. Its IUPAC name is 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide |
| PubChem CID | 91905232 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N(C)CC1CCOCC1 |
| InChI | InChI=1S/C14H20FNO3S/c1-11-3-4-13(15)9-14(11)20(17,18)16(2)10-12-5-7-19-8-6-12/h3-4,9,12H,5-8,10H2,1-2H3 |
| InChIKey | NPAVSDZTZFJRIK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide?
The IUPAC name of 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide (CID 91905232) is 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide?
The canonical SMILES for 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide is Cc1ccc(F)cc1S(=O)(=O)N(C)CC1CCOCC1.
What is the InChIKey of 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide?
The InChIKey is NPAVSDZTZFJRIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO3S/c1-11-3-4-13(15)9-14(11)20(17,18)16(2)10-12-5-7-19-8-6-12/h3-4,9,12H,5-8,10H2,1-2H3.
What are the key properties of 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide?
5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide has a molecular weight of 301.38 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,2-dimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 91905232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).