About 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone
1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone (PubChem CID 91905505) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone.
Molecular Properties
| Compound Name | 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone |
| PubChem CID | 91905505 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone |
| SMILES | Cc1noc(-c2cccc(OC3CN(C(=O)Cc4ccccc4)C3)c2)n1 |
| InChI | InChI=1S/C20H19N3O3/c1-14-21-20(26-22-14)16-8-5-9-17(11-16)25-18-12-23(13-18)19(24)10-15-6-3-2-4-7-15/h2-9,11,18H,10,12-13H2,1H3 |
| InChIKey | FDKRYNUHGMZDBA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone?
The IUPAC name of 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone (CID 91905505) is 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone.
What is the SMILES notation for 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone?
The canonical SMILES for 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone is Cc1noc(-c2cccc(OC3CN(C(=O)Cc4ccccc4)C3)c2)n1.
What is the InChIKey of 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone?
The InChIKey is FDKRYNUHGMZDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3/c1-14-21-20(26-22-14)16-8-5-9-17(11-16)25-18-12-23(13-18)19(24)10-15-6-3-2-4-7-15/h2-9,11,18H,10,12-13H2,1H3.
What are the key properties of 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone?
1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone has a molecular weight of 349.39 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl]-2-phenylethanone is sourced from PubChem (CID 91905505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).