About N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide
N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide (PubChem CID 91905690) has the molecular formula C17H27NO3S
and a molecular weight of 325.47 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide |
| PubChem CID | 91905690 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)N(CCC)CC2CCOC2)cc1 |
| InChI | InChI=1S/C17H27NO3S/c1-3-5-15-6-8-17(9-7-15)22(19,20)18(11-4-2)13-16-10-12-21-14-16/h6-9,16H,3-5,10-14H2,1-2H3 |
| InChIKey | DOGQGMGLCYOGDE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide?
The IUPAC name of N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide (CID 91905690) is N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide.
What is the SMILES notation for N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide?
The canonical SMILES for N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide is CCCc1ccc(S(=O)(=O)N(CCC)CC2CCOC2)cc1.
What is the InChIKey of N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide?
The InChIKey is DOGQGMGLCYOGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3S/c1-3-5-15-6-8-17(9-7-15)22(19,20)18(11-4-2)13-16-10-12-21-14-16/h6-9,16H,3-5,10-14H2,1-2H3.
What are the key properties of N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide?
N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide has a molecular weight of 325.47 g/mol, XLogP of 3.08, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-3-ylmethyl)-N,4-dipropylbenzenesulfonamide is sourced from PubChem (CID 91905690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).