C17H19F3N2O4 — CID 91905915
(3aR,6aS)-5-(2-methoxyethyl)-2-[[2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91905915) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is (3aR,6aS)-5-(2-methoxyethyl)-2-[[2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(2-methoxyethyl)-2-[[2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91905915 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (3aR,6aS)-5-(2-methoxyethyl)-2-[[2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | COCCN1C(=O)[C@H]2CN(Cc3ccccc3OC(F)(F)F)C[C@H]2C1=O |
| InChI | InChI=1S/C17H19F3N2O4/c1-25-7-6-22-15(23)12-9-21(10-13(12)16(22)24)8-11-4-2-3-5-14(11)26-17(18,19)20/h2-5,12-13H,6-10H2,1H3/t12-,13+ |
| InChIKey | JCKGABQECKPJKU-BETUJISGSA-N |
| XLogP | 1.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|