C22H29N3O5 — CID 91906023
(3aR,6aS)-2-[(3,5-dimethoxyphenyl)methyl]-5-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91906023) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (3aR,6aS)-2-[(3,5-dimethoxyphenyl)methyl]-5-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-2-[(3,5-dimethoxyphenyl)methyl]-5-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91906023 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3aR,6aS)-2-[(3,5-dimethoxyphenyl)methyl]-5-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | COc1cc(CN2C[C@@H]3C(=O)N(CCCN4CCCC4=O)C(=O)[C@@H]3C2)cc(OC)c1 |
| InChI | InChI=1S/C22H29N3O5/c1-29-16-9-15(10-17(11-16)30-2)12-23-13-18-19(14-23)22(28)25(21(18)27)8-4-7-24-6-3-5-20(24)26/h9-11,18-19H,3-8,12-14H2,1-2H3/t18-,19+ |
| InChIKey | LGMFDEUDBMLENG-KDURUIRLSA-N |
| XLogP | 1.13 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|