C15H21N5O2S — CID 91906089
3-(ethylamino)-N-(2-methoxyethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxamide (PubChem CID 91906089) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-(ethylamino)-N-(2-methoxyethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxamide.
| Compound Name | 3-(ethylamino)-N-(2-methoxyethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 91906089 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(ethylamino)-N-(2-methoxyethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxamide |
| SMILES | CCNc1ncnc2sc3c(c12)CCN(C(=O)NCCOC)C3 |
| InChI | InChI=1S/C15H21N5O2S/c1-3-16-13-12-10-4-6-20(15(21)17-5-7-22-2)8-11(10)23-14(12)19-9-18-13/h9H,3-8H2,1-2H3,(H,17,21)(H,16,18,19) |
| InChIKey | GKXDOIGKWOHCRO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|