About N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide
N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide (PubChem CID 91906115) has the molecular formula C20H28F2N2O2
and a molecular weight of 366.45 g/mol. Its IUPAC name is N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide.
Molecular Properties
| Compound Name | N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide |
| PubChem CID | 91906115 |
| Molecular Formula | C20H28F2N2O2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide |
| SMILES | CCC(=O)N(C1CCOCC1)C1CCN(Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H28F2N2O2/c1-2-20(25)24(18-7-11-26-12-8-18)17-5-9-23(10-6-17)14-15-13-16(21)3-4-19(15)22/h3-4,13,17-18H,2,5-12,14H2,1H3 |
| InChIKey | ZZYJVBCNZAWTGC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide?
The IUPAC name of N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide (CID 91906115) is N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide.
What is the SMILES notation for N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide?
The canonical SMILES for N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide is CCC(=O)N(C1CCOCC1)C1CCN(Cc2cc(F)ccc2F)CC1.
What is the InChIKey of N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide?
The InChIKey is ZZYJVBCNZAWTGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28F2N2O2/c1-2-20(25)24(18-7-11-26-12-8-18)17-5-9-23(10-6-17)14-15-13-16(21)3-4-19(15)22/h3-4,13,17-18H,2,5-12,14H2,1H3.
What are the key properties of N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide?
N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide has a molecular weight of 366.45 g/mol, XLogP of 3.35, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]-N-(oxan-4-yl)propanamide is sourced from PubChem (CID 91906115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).