C19H18ClN5O — CID 91906824
1-(3-chlorophenyl)-3-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea (PubChem CID 91906824) has the molecular formula C19H18ClN5O and a molecular weight of 367.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 91906824 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2nnc3n2CCCC3)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClN5O/c20-14-4-3-5-16(12-14)22-19(26)21-15-9-7-13(8-10-15)18-24-23-17-6-1-2-11-25(17)18/h3-5,7-10,12H,1-2,6,11H2,(H2,21,22,26) |
| InChIKey | GRJOTNHLRKDVDW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |