C8H7F5N2O — CID 919069
1-[5-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-4-yl]ethanone (PubChem CID 919069) has the molecular formula C8H7F5N2O and a molecular weight of 242.15 g/mol. Its IUPAC name is 1-[5-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-4-yl]ethanone.
| Compound Name | 1-[5-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 919069 |
| Molecular Formula | C8H7F5N2O |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1-[5-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(C(F)(F)C(F)(F)F)n[nH]c1C |
| InChI | InChI=1S/C8H7F5N2O/c1-3-5(4(2)16)6(15-14-3)7(9,10)8(11,12)13/h1-2H3,(H,14,15) |
| InChIKey | JPSLTTUBSIQNSA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|