C18H18FN3O — CID 919070
3-[2-(cyclohexen-1-yl)ethyl]-8-fluoro-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 919070) has the molecular formula C18H18FN3O and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-8-fluoro-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-8-fluoro-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 919070 |
| Molecular Formula | C18H18FN3O |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-8-fluoro-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | O=c1c2[nH]c3ccc(F)cc3c2ncn1CCC1=CCCCC1 |
| InChI | InChI=1S/C18H18FN3O/c19-13-6-7-15-14(10-13)16-17(21-15)18(23)22(11-20-16)9-8-12-4-2-1-3-5-12/h4,6-7,10-11,21H,1-3,5,8-9H2 |
| InChIKey | JRVBRPRMYUZBCS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|