C12H11F3N4O2 — CID 91907174
1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(3,4,5-trifluorophenyl)urea (PubChem CID 91907174) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 91907174 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(3,4,5-trifluorophenyl)urea |
| SMILES | Cc1nc(CCNC(=O)Nc2cc(F)c(F)c(F)c2)no1 |
| InChI | InChI=1S/C12H11F3N4O2/c1-6-17-10(19-21-6)2-3-16-12(20)18-7-4-8(13)11(15)9(14)5-7/h4-5H,2-3H2,1H3,(H2,16,18,20) |
| InChIKey | VZHJEEIWPBGHKT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|