6-bromoquinoline-2,4-dicarboxylic acid

C11H6BrNO4 — CID 919075

IUPAC6-bromoquinoline-2,4-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c2cc(Br)ccc2n1
InChIInChI=1S/C11H6BrNO4/c12-5-1-2-8-6(3-5)7(10(14)15)4-9(13-8)11(16)17/h1-4H,(H,14,15)(H,16,17)
InChIKeyDEAWSKJTMZXPBZ-UHFFFAOYSA-N
MW296.08 g/mol
LogP2.39
Rot. Bonds2

About 6-bromoquinoline-2,4-dicarboxylic acid

6-bromoquinoline-2,4-dicarboxylic acid (PubChem CID 919075) has the molecular formula C11H6BrNO4 and a molecular weight of 296.08 g/mol. Its IUPAC name is 6-bromoquinoline-2,4-dicarboxylic acid.

Molecular Properties

Compound Name6-bromoquinoline-2,4-dicarboxylic acid
PubChem CID919075
Molecular FormulaC11H6BrNO4
Molecular Weight296.08 g/mol
Exact Mass294.95
IUPAC Name6-bromoquinoline-2,4-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c2cc(Br)ccc2n1
InChIInChI=1S/C11H6BrNO4/c12-5-1-2-8-6(3-5)7(10(14)15)4-9(13-8)11(16)17/h1-4H,(H,14,15)(H,16,17)
InChIKeyDEAWSKJTMZXPBZ-UHFFFAOYSA-N
XLogP2.39
TPSA87.49 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.08
LogP ≤ 52.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-bromoquinoline-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromoquinoline-2,4-dicarboxylic acid?
The IUPAC name of 6-bromoquinoline-2,4-dicarboxylic acid (CID 919075) is 6-bromoquinoline-2,4-dicarboxylic acid.
What is the SMILES notation for 6-bromoquinoline-2,4-dicarboxylic acid?
The canonical SMILES for 6-bromoquinoline-2,4-dicarboxylic acid is O=C(O)c1cc(C(=O)O)c2cc(Br)ccc2n1.
What is the InChIKey of 6-bromoquinoline-2,4-dicarboxylic acid?
The InChIKey is DEAWSKJTMZXPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrNO4/c12-5-1-2-8-6(3-5)7(10(14)15)4-9(13-8)11(16)17/h1-4H,(H,14,15)(H,16,17).
What are the key properties of 6-bromoquinoline-2,4-dicarboxylic acid?
6-bromoquinoline-2,4-dicarboxylic acid has a molecular weight of 296.08 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoquinoline-2,4-dicarboxylic acid is sourced from PubChem (CID 919075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).