C20H24N2O5 — CID 91907670
(3,4-dimethoxyphenyl)-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 91907670) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 91907670 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | COCCOc1ccc2c(n1)CCN(C(=O)c1ccc(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C20H24N2O5/c1-24-10-11-27-19-7-5-15-13-22(9-8-16(15)21-19)20(23)14-4-6-17(25-2)18(12-14)26-3/h4-7,12H,8-11,13H2,1-3H3 |
| InChIKey | YPJAYZVJFJICFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|