About [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone
[3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone (PubChem CID 91907883) has the molecular formula C16H23N5O3
and a molecular weight of 333.39 g/mol. Its IUPAC name is [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone |
| PubChem CID | 91907883 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone |
| SMILES | CCOCc1nc(C2CCCN(C(=O)c3ccnn3CC)C2)no1 |
| InChI | InChI=1S/C16H23N5O3/c1-3-21-13(7-8-17-21)16(22)20-9-5-6-12(10-20)15-18-14(24-19-15)11-23-4-2/h7-8,12H,3-6,9-11H2,1-2H3 |
| InChIKey | RRBQKEVVXWFPIL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone?
The IUPAC name of [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone (CID 91907883) is [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone.
What is the SMILES notation for [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone?
The canonical SMILES for [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone is CCOCc1nc(C2CCCN(C(=O)c3ccnn3CC)C2)no1.
What is the InChIKey of [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone?
The InChIKey is RRBQKEVVXWFPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O3/c1-3-21-13(7-8-17-21)16(22)20-9-5-6-12(10-20)15-18-14(24-19-15)11-23-4-2/h7-8,12H,3-6,9-11H2,1-2H3.
What are the key properties of [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone?
[3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone has a molecular weight of 333.39 g/mol, XLogP of 1.84, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-(2-ethylpyrazol-3-yl)methanone is sourced from PubChem (CID 91907883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).