C19H17F3N4O2 — CID 91908626
2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 91908626) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91908626 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)Nc1cccc(C(F)(F)F)c1)CCC3 |
| InChI | InChI=1S/C19H17F3N4O2/c1-11-8-14-17(18(28)25-7-3-6-15(25)24-14)26(11)10-16(27)23-13-5-2-4-12(9-13)19(20,21)22/h2,4-5,8-9H,3,6-7,10H2,1H3,(H,23,27) |
| InChIKey | LQCJVRGHQLHWIR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |