C19H20N4O3 — CID 91908632
N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908632) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908632 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1c(C)cc2nc3n(c(=O)c21)CCC3 |
| InChI | InChI=1S/C19H20N4O3/c1-12-10-14-18(19(25)22-9-5-8-16(22)20-14)23(12)11-17(24)21-13-6-3-4-7-15(13)26-2/h3-4,6-7,10H,5,8-9,11H2,1-2H3,(H,21,24) |
| InChIKey | ZQVCTVIOFTUDCN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |