C18H16F2N4O2 — CID 91908640
N-(2,4-difluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908640) has the molecular formula C18H16F2N4O2 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908640 |
| Molecular Formula | C18H16F2N4O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)Nc1ccc(F)cc1F)CCC3 |
| InChI | InChI=1S/C18H16F2N4O2/c1-10-7-14-17(18(26)23-6-2-3-15(23)21-14)24(10)9-16(25)22-13-5-4-11(19)8-12(13)20/h4-5,7-8H,2-3,6,9H2,1H3,(H,22,25) |
| InChIKey | XSOIGWOWAVHZIY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |