C20H21ClN4O2 — CID 91908656
N-[(2-chlorophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908656) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908656 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)NCc1ccccc1Cl)CCCC3 |
| InChI | InChI=1S/C20H21ClN4O2/c1-13-10-16-19(20(27)24-9-5-4-8-17(24)23-16)25(13)12-18(26)22-11-14-6-2-3-7-15(14)21/h2-3,6-7,10H,4-5,8-9,11-12H2,1H3,(H,22,26) |
| InChIKey | ROYYSDBFHKRZAO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |