C22H24N4O2 — CID 91908657
4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one (PubChem CID 91908657) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one.
| Compound Name | 4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one |
|---|---|
| PubChem CID | 91908657 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)N1CCCc2ccccc21)CCCC3 |
| InChI | InChI=1S/C22H24N4O2/c1-15-13-17-21(22(28)25-11-5-4-10-19(25)23-17)26(15)14-20(27)24-12-6-8-16-7-2-3-9-18(16)24/h2-3,7,9,13H,4-6,8,10-12,14H2,1H3 |
| InChIKey | LGULCIOZZPQMGW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |