C19H19FN4O2 — CID 91908670
N-(2-fluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908670) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-(2-fluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908670 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(2-fluorophenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)Nc1ccccc1F)CCCC3 |
| InChI | InChI=1S/C19H19FN4O2/c1-12-10-15-18(19(26)23-9-5-4-8-16(23)21-15)24(12)11-17(25)22-14-7-3-2-6-13(14)20/h2-3,6-7,10H,4-5,8-9,11H2,1H3,(H,22,25) |
| InChIKey | OLYBVMPCXFTMLO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |