C22H26N4O3 — CID 91908697
N-[1-(4-methoxyphenyl)ethyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908697) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908697 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | COc1ccc(C(C)NC(=O)Cn2c(C)cc3nc4n(c(=O)c32)CCCC4)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-14-12-18-21(22(28)25-11-5-4-6-19(25)24-18)26(14)13-20(27)23-15(2)16-7-9-17(29-3)10-8-16/h7-10,12,15H,4-6,11,13H2,1-3H3,(H,23,27) |
| InChIKey | OMMYRJOEWFADNJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |