C21H24N4O3 — CID 91908712
N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908712) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908712 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1c(C)cc2nc3n(c(=O)c21)CCCCC3 |
| InChI | InChI=1S/C21H24N4O3/c1-14-12-16-20(21(27)24-11-7-3-4-10-18(24)22-16)25(14)13-19(26)23-15-8-5-6-9-17(15)28-2/h5-6,8-9,12H,3-4,7,10-11,13H2,1-2H3,(H,23,26) |
| InChIKey | LUZPLBQMXOBAPS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |