C25H31N5O3 — CID 91908715
4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one (PubChem CID 91908715) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one.
| Compound Name | 4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one |
|---|---|
| PubChem CID | 91908715 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one |
| SMILES | COc1ccccc1N1CCN(C(=O)Cn2c(C)cc3nc4n(c(=O)c32)CCCCC4)CC1 |
| InChI | InChI=1S/C25H31N5O3/c1-18-16-19-24(25(32)29-11-7-3-4-10-22(29)26-19)30(18)17-23(31)28-14-12-27(13-15-28)20-8-5-6-9-21(20)33-2/h5-6,8-9,16H,3-4,7,10-15,17H2,1-2H3 |
| InChIKey | XSSMWFCYDKMYPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |