C20H29N5O3 — CID 91909038
2-(2-cyclopropyl-5-oxo-8,9-dihydro-7H-pyrimido[5,4-c]azepin-6-yl)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 91909038) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-(2-cyclopropyl-5-oxo-8,9-dihydro-7H-pyrimido[5,4-c]azepin-6-yl)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(2-cyclopropyl-5-oxo-8,9-dihydro-7H-pyrimido[5,4-c]azepin-6-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 91909038 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(2-cyclopropyl-5-oxo-8,9-dihydro-7H-pyrimido[5,4-c]azepin-6-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(CN1CCCc2nc(C3CC3)ncc2C1=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H29N5O3/c26-18(21-6-2-7-24-9-11-28-12-10-24)14-25-8-1-3-17-16(20(25)27)13-22-19(23-17)15-4-5-15/h13,15H,1-12,14H2,(H,21,26) |
| InChIKey | SVJXRLWTWOVDPR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|