About 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide
3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide (PubChem CID 91909633) has the molecular formula C16H19N3O4S
and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide |
| PubChem CID | 91909633 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)NCC2Cn3cccc3C(=O)N2C)c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-18-12(11-19-8-4-7-15(19)16(18)20)10-17-24(21,22)14-6-3-5-13(9-14)23-2/h3-9,12,17H,10-11H2,1-2H3 |
| InChIKey | DKXVPWLEMLIRQI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide?
The IUPAC name of 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide (CID 91909633) is 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide?
The canonical SMILES for 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide is COc1cccc(S(=O)(=O)NCC2Cn3cccc3C(=O)N2C)c1.
What is the InChIKey of 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide?
The InChIKey is DKXVPWLEMLIRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4S/c1-18-12(11-19-8-4-7-15(19)16(18)20)10-17-24(21,22)14-6-3-5-13(9-14)23-2/h3-9,12,17H,10-11H2,1-2H3.
What are the key properties of 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide?
3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide has a molecular weight of 349.41 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-[(2-methyl-1-oxo-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 91909633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).