About 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one
8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 91909779) has the molecular formula C17H22N2O4S2
and a molecular weight of 382.51 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 91909779 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CS(=O)C2(CCN(S(=O)(=O)c3ccccc3)CC2)N1CC1CC1 |
| InChI | InChI=1S/C17H22N2O4S2/c20-16-13-24(21)17(19(16)12-14-6-7-14)8-10-18(11-9-17)25(22,23)15-4-2-1-3-5-15/h1-5,14H,6-13H2 |
| InChIKey | CJKLFFUGBRHMJZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (CID 91909779) is 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is O=C1CS(=O)C2(CCN(S(=O)(=O)c3ccccc3)CC2)N1CC1CC1.
What is the InChIKey of 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The InChIKey is CJKLFFUGBRHMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4S2/c20-16-13-24(21)17(19(16)12-14-6-7-14)8-10-18(11-9-17)25(22,23)15-4-2-1-3-5-15/h1-5,14H,6-13H2.
What are the key properties of 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one has a molecular weight of 382.51 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(benzenesulfonyl)-4-(cyclopropylmethyl)-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 91909779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).