C17H21FN4O4 — CID 91909855
N-(2-fluorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxamide (PubChem CID 91909855) has the molecular formula C17H21FN4O4 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91909855 |
| Molecular Formula | C17H21FN4O4 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(2-fluorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxamide |
| SMILES | COCCOCc1nc(C2CCCN2C(=O)Nc2ccccc2F)no1 |
| InChI | InChI=1S/C17H21FN4O4/c1-24-9-10-25-11-15-20-16(21-26-15)14-7-4-8-22(14)17(23)19-13-6-3-2-5-12(13)18/h2-3,5-6,14H,4,7-11H2,1H3,(H,19,23) |
| InChIKey | CTXZIMCBTZOLHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|