C18H25N5O4 — CID 91909988
[3-[3-[2-(oxan-4-ylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 91909988) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is [3-[3-[2-(oxan-4-ylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [3-[3-[2-(oxan-4-ylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 91909988 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [3-[3-[2-(oxan-4-ylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1CCC(c2nc(CCOCC3CCOCC3)no2)C1 |
| InChI | InChI=1S/C18H25N5O4/c24-18(15-1-6-19-21-15)23-7-2-14(11-23)17-20-16(22-27-17)5-10-26-12-13-3-8-25-9-4-13/h1,6,13-14H,2-5,7-12H2,(H,19,21) |
| InChIKey | KNFMHQKGDHMLPY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|