C16H21F3N2O2S — CID 91910156
4-pyrrolidin-3-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 91910156) has the molecular formula C16H21F3N2O2S and a molecular weight of 362.42 g/mol. Its IUPAC name is 4-pyrrolidin-3-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-pyrrolidin-3-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 91910156 |
| Molecular Formula | C16H21F3N2O2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-pyrrolidin-3-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCC(C2CCNC2)CC1 |
| InChI | InChI=1S/C16H21F3N2O2S/c17-16(18,19)14-1-3-15(4-2-14)24(22,23)21-9-6-12(7-10-21)13-5-8-20-11-13/h1-4,12-13,20H,5-11H2 |
| InChIKey | NULJFVZSWJZLKZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |