C18H25FN2O3S — CID 91910267
2-(3-fluorophenyl)-1-[3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]ethanone (PubChem CID 91910267) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91910267 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CS(=O)(=O)N1CCC(C2CCN(C(=O)Cc3cccc(F)c3)C2)CC1 |
| InChI | InChI=1S/C18H25FN2O3S/c1-25(23,24)21-9-6-15(7-10-21)16-5-8-20(13-16)18(22)12-14-3-2-4-17(19)11-14/h2-4,11,15-16H,5-10,12-13H2,1H3 |
| InChIKey | ZBRQQYHREIACMW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |