About 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone
1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone (PubChem CID 91910476) has the molecular formula C19H28N2O4S
and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone.
Molecular Properties
| Compound Name | 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone |
| PubChem CID | 91910476 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone |
| SMILES | COCC1CN(C(=O)Cc2ccc(S(C)(=O)=O)cc2)CC12CCNCC2 |
| InChI | InChI=1S/C19H28N2O4S/c1-25-13-16-12-21(14-19(16)7-9-20-10-8-19)18(22)11-15-3-5-17(6-4-15)26(2,23)24/h3-6,16,20H,7-14H2,1-2H3 |
| InChIKey | VEHHAQFKHMLWMD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone?
The IUPAC name of 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone (CID 91910476) is 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone.
What is the SMILES notation for 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone?
The canonical SMILES for 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone is COCC1CN(C(=O)Cc2ccc(S(C)(=O)=O)cc2)CC12CCNCC2.
What is the InChIKey of 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone?
The InChIKey is VEHHAQFKHMLWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O4S/c1-25-13-16-12-21(14-19(16)7-9-20-10-8-19)18(22)11-15-3-5-17(6-4-15)26(2,23)24/h3-6,16,20H,7-14H2,1-2H3.
What are the key properties of 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone?
1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone has a molecular weight of 380.51 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(4-methylsulfonylphenyl)ethanone is sourced from PubChem (CID 91910476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).