C19H26N4O5 — CID 91910659
7-[2-(3,4-dimethoxyphenyl)acetyl]-2-(2-methoxyethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one (PubChem CID 91910659) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 7-[2-(3,4-dimethoxyphenyl)acetyl]-2-(2-methoxyethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one.
| Compound Name | 7-[2-(3,4-dimethoxyphenyl)acetyl]-2-(2-methoxyethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one |
|---|---|
| PubChem CID | 91910659 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 7-[2-(3,4-dimethoxyphenyl)acetyl]-2-(2-methoxyethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one |
| SMILES | COCCn1nc2n(c1=O)CCN(C(=O)Cc1ccc(OC)c(OC)c1)CC2 |
| InChI | InChI=1S/C19H26N4O5/c1-26-11-10-23-19(25)22-9-8-21(7-6-17(22)20-23)18(24)13-14-4-5-15(27-2)16(12-14)28-3/h4-5,12H,6-11,13H2,1-3H3 |
| InChIKey | PDBDLYNPDZJPRU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |