C20H24N4O — CID 91910744
N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 91910744) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91910744 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NC1CCc2nnc(C3CC3)n2CC1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O/c25-19(20(11-12-20)15-4-2-1-3-5-15)21-16-8-9-17-22-23-18(14-6-7-14)24(17)13-10-16/h1-5,14,16H,6-13H2,(H,21,25) |
| InChIKey | ZFHDWJUHICQJDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |