C17H24N4O — CID 91910774
N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 91910774) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 91910774 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-(3-cyclopropyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC1CCc2nnc(C3CC3)n2CC1)C1CC=CCC1 |
| InChI | InChI=1S/C17H24N4O/c22-17(13-4-2-1-3-5-13)18-14-8-9-15-19-20-16(12-6-7-12)21(15)11-10-14/h1-2,12-14H,3-11H2,(H,18,22) |
| InChIKey | ARCCDHGJPVNQMM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|