C14H17FN4O3S — CID 91910821
1-(3-fluorophenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)methanesulfonamide (PubChem CID 91910821) has the molecular formula C14H17FN4O3S and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)methanesulfonamide.
| Compound Name | 1-(3-fluorophenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)methanesulfonamide |
|---|---|
| PubChem CID | 91910821 |
| Molecular Formula | C14H17FN4O3S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)methanesulfonamide |
| SMILES | O=c1[nH]nc2n1CCC(NS(=O)(=O)Cc1cccc(F)c1)CC2 |
| InChI | InChI=1S/C14H17FN4O3S/c15-11-3-1-2-10(8-11)9-23(21,22)18-12-4-5-13-16-17-14(20)19(13)7-6-12/h1-3,8,12,18H,4-7,9H2,(H,17,20) |
| InChIKey | SBFRPSPPIIFMQY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |