C19H26N4O3 — CID 91910865
3-(2-methoxyphenyl)-N-methyl-N-(2-methyl-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)propanamide (PubChem CID 91910865) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-methyl-N-(2-methyl-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)propanamide.
| Compound Name | 3-(2-methoxyphenyl)-N-methyl-N-(2-methyl-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)propanamide |
|---|---|
| PubChem CID | 91910865 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-methyl-N-(2-methyl-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)propanamide |
| SMILES | COc1ccccc1CCC(=O)N(C)C1CCc2nn(C)c(=O)n2CC1 |
| InChI | InChI=1S/C19H26N4O3/c1-21(18(24)11-8-14-6-4-5-7-16(14)26-3)15-9-10-17-20-22(2)19(25)23(17)13-12-15/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | LORBSTVGXWCVQZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |