C22H30N4O3 — CID 91910881
N-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(3-methoxyphenyl)-N-methylpropanamide (PubChem CID 91910881) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(3-methoxyphenyl)-N-methylpropanamide.
| Compound Name | N-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(3-methoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 91910881 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(3-methoxyphenyl)-N-methylpropanamide |
| SMILES | COc1cccc(CCC(=O)N(C)C2CCc3nn(CC4CC4)c(=O)n3CC2)c1 |
| InChI | InChI=1S/C22H30N4O3/c1-24(21(27)11-8-16-4-3-5-19(14-16)29-2)18-9-10-20-23-26(15-17-6-7-17)22(28)25(20)13-12-18/h3-5,14,17-18H,6-13,15H2,1-2H3 |
| InChIKey | LMEPGOGQQOHZOY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |