C15H24N6O — CID 91910910
7-[(2,5-dimethylpyrazol-3-yl)methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one (PubChem CID 91910910) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 7-[(2,5-dimethylpyrazol-3-yl)methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one.
| Compound Name | 7-[(2,5-dimethylpyrazol-3-yl)methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
|---|---|
| PubChem CID | 91910910 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 7-[(2,5-dimethylpyrazol-3-yl)methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
| SMILES | Cc1cc(CN(C)C2CCc3nn(C)c(=O)n3CC2)n(C)n1 |
| InChI | InChI=1S/C15H24N6O/c1-11-9-13(19(3)16-11)10-18(2)12-5-6-14-17-20(4)15(22)21(14)8-7-12/h9,12H,5-8,10H2,1-4H3 |
| InChIKey | SCTSHDKGWLNPHF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 60.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |